C17H38O5 — CID 142954615
1-(3-heptoxyoxolan-2-yl)ethanol;methane;propane-2,2-diol (PubChem CID 142954615) has the molecular formula C17H38O5 and a molecular weight of 322.49 g/mol. Its IUPAC name is 1-(3-heptoxyoxolan-2-yl)ethanol;methane;propane-2,2-diol.
| Compound Name | 1-(3-heptoxyoxolan-2-yl)ethanol;methane;propane-2,2-diol |
|---|---|
| PubChem CID | 142954615 |
| Molecular Formula | C17H38O5 |
| Molecular Weight | 322.49 g/mol |
| Exact Mass | 322.27 |
| IUPAC Name | 1-(3-heptoxyoxolan-2-yl)ethanol;methane;propane-2,2-diol |
| SMILES | C.CC(C)(O)O.CCCCCCCOC1CCOC1C(C)O |
| InChI | InChI=1S/C13H26O3.C3H8O2.CH4/c1-3-4-5-6-7-9-15-12-8-10-16-13(12)11(2)14;1-3(2,4)5;/h11-14H,3-10H2,1-2H3;4-5H,1-2H3;1H4 |
| InChIKey | FMPSSDPPSIPCFQ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.49 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|