C27H36FN5O3 — CID 142956766
(6S,9aS)-1-[(benzylamino)-hydroxymethyl]-8-[1-(4-fluorophenyl)ethyl]-2-methyl-6-(2-methylpropyl)-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-4,7-dione (PubChem CID 142956766) has the molecular formula C27H36FN5O3 and a molecular weight of 497.62 g/mol. Its IUPAC name is (6S,9aS)-1-[(benzylamino)-hydroxymethyl]-8-[1-(4-fluorophenyl)ethyl]-2-methyl-6-(2-methylpropyl)-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-4,7-dione.
| Compound Name | (6S,9aS)-1-[(benzylamino)-hydroxymethyl]-8-[1-(4-fluorophenyl)ethyl]-2-methyl-6-(2-methylpropyl)-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-4,7-dione |
|---|---|
| PubChem CID | 142956766 |
| Molecular Formula | C27H36FN5O3 |
| Molecular Weight | 497.62 g/mol |
| Exact Mass | 497.28 |
| IUPAC Name | (6S,9aS)-1-[(benzylamino)-hydroxymethyl]-8-[1-(4-fluorophenyl)ethyl]-2-methyl-6-(2-methylpropyl)-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-4,7-dione |
| SMILES | CC(C)C[C@H]1C(=O)N(C(C)c2ccc(F)cc2)C[C@H]2N1C(=O)CN(C)N2C(O)NCc1ccccc1 |
| InChI | InChI=1S/C27H36FN5O3/c1-18(2)14-23-26(35)31(19(3)21-10-12-22(28)13-11-21)16-24-32(23)25(34)17-30(4)33(24)27(36)29-15-20-8-6-5-7-9-20/h5-13,18-19,23-24,27,29,36H,14-17H2,1-4H3/t19?,23-,24-,27?/m0/s1 |
| InChIKey | REMOFSYWOLQWCE-QSJLPBGRSA-N |
| XLogP | 2.53 |
| TPSA | 79.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.62 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|