C20H26O2S2 — CID 142957850
(Z)-6-cyclopenta-1,3-dien-1-yl-3-(4-ethoxyphenyl)hex-5-ene-2,2-dithiol;formaldehyde (PubChem CID 142957850) has the molecular formula C20H26O2S2 and a molecular weight of 362.56 g/mol. Its IUPAC name is (Z)-6-cyclopenta-1,3-dien-1-yl-3-(4-ethoxyphenyl)hex-5-ene-2,2-dithiol;formaldehyde.
| Compound Name | (Z)-6-cyclopenta-1,3-dien-1-yl-3-(4-ethoxyphenyl)hex-5-ene-2,2-dithiol;formaldehyde |
|---|---|
| PubChem CID | 142957850 |
| Molecular Formula | C20H26O2S2 |
| Molecular Weight | 362.56 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | (Z)-6-cyclopenta-1,3-dien-1-yl-3-(4-ethoxyphenyl)hex-5-ene-2,2-dithiol;formaldehyde |
| SMILES | C=O.CCOc1ccc(C(C/C=C\C2=CC=CC2)C(C)(S)S)cc1 |
| InChI | InChI=1S/C19H24OS2.CH2O/c1-3-20-17-13-11-16(12-14-17)18(19(2,21)22)10-6-9-15-7-4-5-8-15;1-2/h4-7,9,11-14,18,21-22H,3,8,10H2,1-2H3;1H2/b9-6-; |
| InChIKey | ILOSTURVHVFTLA-BORNJIKYSA-N |
| XLogP | 5.39 |
| TPSA | 26.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.56 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|