C32H45N5O8 — CID 142958307
[4-oxo-4-[(2-oxoazepan-3-yl)amino]butan-2-yl] 2-[[2-(2-hydroxyphenyl)-4-methyl-5H-1,3-oxazole-4-carbonyl]amino]-6-[[(Z)-pent-2-enoyl]amino]hexanoate (PubChem CID 142958307) has the molecular formula C32H45N5O8 and a molecular weight of 627.74 g/mol. Its IUPAC name is [4-oxo-4-[(2-oxoazepan-3-yl)amino]butan-2-yl] 2-[[2-(2-hydroxyphenyl)-4-methyl-5H-1,3-oxazole-4-carbonyl]amino]-6-[[(Z)-pent-2-enoyl]amino]hexanoate.
| Compound Name | [4-oxo-4-[(2-oxoazepan-3-yl)amino]butan-2-yl] 2-[[2-(2-hydroxyphenyl)-4-methyl-5H-1,3-oxazole-4-carbonyl]amino]-6-[[(Z)-pent-2-enoyl]amino]hexanoate |
|---|---|
| PubChem CID | 142958307 |
| Molecular Formula | C32H45N5O8 |
| Molecular Weight | 627.74 g/mol |
| Exact Mass | 627.33 |
| IUPAC Name | [4-oxo-4-[(2-oxoazepan-3-yl)amino]butan-2-yl] 2-[[2-(2-hydroxyphenyl)-4-methyl-5H-1,3-oxazole-4-carbonyl]amino]-6-[[(Z)-pent-2-enoyl]amino]hexanoate |
| SMILES | CC/C=C\C(=O)NCCCCC(NC(=O)C1(C)COC(c2ccccc2O)=N1)C(=O)OC(C)CC(=O)NC1CCCCNC1=O |
| InChI | InChI=1S/C32H45N5O8/c1-4-5-16-26(39)33-17-10-9-14-24(30(42)45-21(2)19-27(40)35-23-13-8-11-18-34-28(23)41)36-31(43)32(3)20-44-29(37-32)22-12-6-7-15-25(22)38/h5-7,12,15-16,21,23-24,38H,4,8-11,13-14,17-20H2,1-3H3,(H,33,39)(H,34,41)(H,35,40)(H,36,43)/b16-5- |
| InChIKey | BVGZJZXVQLQCNU-BNCCVWRVSA-N |
| XLogP | 1.77 |
| TPSA | 184.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.74 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|