C17H24O3 — CID 142958494
(4R,4'aS)-4-ethenyl-4'a-methylspiro[1,3-dioxolane-2,5'-4,6,7,8-tetrahydro-3H-naphthalene]-2'-one;ethene (PubChem CID 142958494) has the molecular formula C17H24O3 and a molecular weight of 276.38 g/mol. Its IUPAC name is (4R,4'aS)-4-ethenyl-4'a-methylspiro[1,3-dioxolane-2,5'-4,6,7,8-tetrahydro-3H-naphthalene]-2'-one;ethene.
| Compound Name | (4R,4'aS)-4-ethenyl-4'a-methylspiro[1,3-dioxolane-2,5'-4,6,7,8-tetrahydro-3H-naphthalene]-2'-one;ethene |
|---|---|
| PubChem CID | 142958494 |
| Molecular Formula | C17H24O3 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | (4R,4'aS)-4-ethenyl-4'a-methylspiro[1,3-dioxolane-2,5'-4,6,7,8-tetrahydro-3H-naphthalene]-2'-one;ethene |
| SMILES | C=C.C=C[C@@H]1COC2(CCCC3=CC(=O)CC[C@@]32C)O1 |
| InChI | InChI=1S/C15H20O3.C2H4/c1-3-13-10-17-15(18-13)7-4-5-11-9-12(16)6-8-14(11,15)2;1-2/h3,9,13H,1,4-8,10H2,2H3;1-2H2/t13-,14+,15?;/m1./s1 |
| InChIKey | STVWSTIMPMPZOV-LEEBFMFHSA-N |
| XLogP | 3.57 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|