C17H26O3 — CID 14352391
4a-methyl-1-[2-(2-methyl-1,3-dioxolan-2-yl)ethyl]-3,4,5,6,7,8-hexahydronaphthalen-2-one (PubChem CID 14352391) has the molecular formula C17H26O3 and a molecular weight of 278.39 g/mol. Its IUPAC name is 4a-methyl-1-[2-(2-methyl-1,3-dioxolan-2-yl)ethyl]-3,4,5,6,7,8-hexahydronaphthalen-2-one.
| Compound Name | 4a-methyl-1-[2-(2-methyl-1,3-dioxolan-2-yl)ethyl]-3,4,5,6,7,8-hexahydronaphthalen-2-one |
|---|---|
| PubChem CID | 14352391 |
| Molecular Formula | C17H26O3 |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | 4a-methyl-1-[2-(2-methyl-1,3-dioxolan-2-yl)ethyl]-3,4,5,6,7,8-hexahydronaphthalen-2-one |
| SMILES | CC1(CCC2=C3CCCCC3(C)CCC2=O)OCCO1 |
| InChI | InChI=1S/C17H26O3/c1-16-8-4-3-5-14(16)13(15(18)7-9-16)6-10-17(2)19-11-12-20-17/h3-12H2,1-2H3 |
| InChIKey | MVVVCMWOPDZHRF-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |