C18H24F3N3S — CID 142958933
3-[1-[(Z)-but-2-enyl]-4-(trifluoromethyl)imidazol-2-yl]pyridine;ethane;(E)-prop-1-ene-1-thiol (PubChem CID 142958933) has the molecular formula C18H24F3N3S and a molecular weight of 371.47 g/mol. Its IUPAC name is 3-[1-[(Z)-but-2-enyl]-4-(trifluoromethyl)imidazol-2-yl]pyridine;ethane;(E)-prop-1-ene-1-thiol.
| Compound Name | 3-[1-[(Z)-but-2-enyl]-4-(trifluoromethyl)imidazol-2-yl]pyridine;ethane;(E)-prop-1-ene-1-thiol |
|---|---|
| PubChem CID | 142958933 |
| Molecular Formula | C18H24F3N3S |
| Molecular Weight | 371.47 g/mol |
| Exact Mass | 371.16 |
| IUPAC Name | 3-[1-[(Z)-but-2-enyl]-4-(trifluoromethyl)imidazol-2-yl]pyridine;ethane;(E)-prop-1-ene-1-thiol |
| SMILES | C/C=C/S.C/C=C\Cn1cc(C(F)(F)F)nc1-c1cccnc1.CC |
| InChI | InChI=1S/C13H12F3N3.C3H6S.C2H6/c1-2-3-7-19-9-11(13(14,15)16)18-12(19)10-5-4-6-17-8-10;1-2-3-4;1-2/h2-6,8-9H,7H2,1H3;2-4H,1H3;1-2H3/b3-2-;3-2+; |
| InChIKey | GDYWQXQWEPAPQG-WRSPJYQPSA-N |
| XLogP | 6.02 |
| TPSA | 30.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.47 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|