C15H9F3N3O2S- — CID 67555793
4-[2-pyridin-3-yl-4-(trifluoromethyl)imidazol-1-yl]benzenesulfinate (PubChem CID 67555793) has the molecular formula C15H9F3N3O2S- and a molecular weight of 352.32 g/mol. Its IUPAC name is 4-[2-pyridin-3-yl-4-(trifluoromethyl)imidazol-1-yl]benzenesulfinate.
| Compound Name | 4-[2-pyridin-3-yl-4-(trifluoromethyl)imidazol-1-yl]benzenesulfinate |
|---|---|
| PubChem CID | 67555793 |
| Molecular Formula | C15H9F3N3O2S- |
| Molecular Weight | 352.32 g/mol |
| Exact Mass | 352.04 |
| IUPAC Name | 4-[2-pyridin-3-yl-4-(trifluoromethyl)imidazol-1-yl]benzenesulfinate |
| SMILES | O=S([O-])c1ccc(-n2cc(C(F)(F)F)nc2-c2cccnc2)cc1 |
| InChI | InChI=1S/C15H10F3N3O2S/c16-15(17,18)13-9-21(11-3-5-12(6-4-11)24(22)23)14(20-13)10-2-1-7-19-8-10/h1-9H,(H,22,23)/p-1 |
| InChIKey | RHEUGPFHXBWPDW-UHFFFAOYSA-M |
| XLogP | 3.19 |
| TPSA | 70.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.32 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|