C18H17N3O4S — CID 10499452
ethyl 1-(4-methylsulfonylphenyl)-2-pyridin-3-ylimidazole-4-carboxylate (PubChem CID 10499452) has the molecular formula C18H17N3O4S and a molecular weight of 371.42 g/mol. Its IUPAC name is ethyl 1-(4-methylsulfonylphenyl)-2-pyridin-3-ylimidazole-4-carboxylate.
| Compound Name | ethyl 1-(4-methylsulfonylphenyl)-2-pyridin-3-ylimidazole-4-carboxylate |
|---|---|
| PubChem CID | 10499452 |
| Molecular Formula | C18H17N3O4S |
| Molecular Weight | 371.42 g/mol |
| Exact Mass | 371.09 |
| IUPAC Name | ethyl 1-(4-methylsulfonylphenyl)-2-pyridin-3-ylimidazole-4-carboxylate |
| SMILES | CCOC(=O)c1cn(-c2ccc(S(C)(=O)=O)cc2)c(-c2cccnc2)n1 |
| InChI | InChI=1S/C18H17N3O4S/c1-3-25-18(22)16-12-21(17(20-16)13-5-4-10-19-11-13)14-6-8-15(9-7-14)26(2,23)24/h4-12H,3H2,1-2H3 |
| InChIKey | MRSPIUOFEMHXAB-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 91.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.42 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |