C17H12ClN3O5 — CID 142960204
3-(5-chloro-2-hydroxy-4-nitrosophenyl)-4-(4-methoxyphenyl)-1H-pyrazole-5-carboxylic acid (PubChem CID 142960204) has the molecular formula C17H12ClN3O5 and a molecular weight of 373.75 g/mol. Its IUPAC name is 3-(5-chloro-2-hydroxy-4-nitrosophenyl)-4-(4-methoxyphenyl)-1H-pyrazole-5-carboxylic acid.
| Compound Name | 3-(5-chloro-2-hydroxy-4-nitrosophenyl)-4-(4-methoxyphenyl)-1H-pyrazole-5-carboxylic acid |
|---|---|
| PubChem CID | 142960204 |
| Molecular Formula | C17H12ClN3O5 |
| Molecular Weight | 373.75 g/mol |
| Exact Mass | 373.05 |
| IUPAC Name | 3-(5-chloro-2-hydroxy-4-nitrosophenyl)-4-(4-methoxyphenyl)-1H-pyrazole-5-carboxylic acid |
| SMILES | COc1ccc(-c2c(-c3cc(Cl)c(N=O)cc3O)n[nH]c2C(=O)O)cc1 |
| InChI | InChI=1S/C17H12ClN3O5/c1-26-9-4-2-8(3-5-9)14-15(19-20-16(14)17(23)24)10-6-11(18)12(21-25)7-13(10)22/h2-7,22H,1H3,(H,19,20)(H,23,24) |
| InChIKey | ZTOBZTNSSSLMKH-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 124.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.75 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |