C24H19N5O6 — CID 137167775
2-[4,6-bis(4-methoxy-2-nitrosophenyl)-1,3,5-triazin-2-yl]-5-methoxyphenol (PubChem CID 137167775) has the molecular formula C24H19N5O6 and a molecular weight of 473.45 g/mol. Its IUPAC name is 2-[4,6-bis(4-methoxy-2-nitrosophenyl)-1,3,5-triazin-2-yl]-5-methoxyphenol.
| Compound Name | 2-[4,6-bis(4-methoxy-2-nitrosophenyl)-1,3,5-triazin-2-yl]-5-methoxyphenol |
|---|---|
| PubChem CID | 137167775 |
| Molecular Formula | C24H19N5O6 |
| Molecular Weight | 473.45 g/mol |
| Exact Mass | 473.13 |
| IUPAC Name | 2-[4,6-bis(4-methoxy-2-nitrosophenyl)-1,3,5-triazin-2-yl]-5-methoxyphenol |
| SMILES | COc1ccc(-c2nc(-c3ccc(OC)cc3N=O)nc(-c3ccc(OC)cc3N=O)n2)c(O)c1 |
| InChI | InChI=1S/C24H19N5O6/c1-33-13-4-7-16(19(10-13)28-31)22-25-23(17-8-5-14(34-2)11-20(17)29-32)27-24(26-22)18-9-6-15(35-3)12-21(18)30/h4-12,30H,1-3H3 |
| InChIKey | YOPSDTFFNXGRJZ-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 145.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.45 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |