C18H27N5O — CID 142964094
but-1-ene;2-(cyclopent-2-en-1-ylmethyl)-4-[[(Z)-ethylideneamino]methylamino]-5-methanimidoyl-1H-pyrimidin-6-one (PubChem CID 142964094) has the molecular formula C18H27N5O and a molecular weight of 329.45 g/mol. Its IUPAC name is but-1-ene;2-(cyclopent-2-en-1-ylmethyl)-4-[[(Z)-ethylideneamino]methylamino]-5-methanimidoyl-1H-pyrimidin-6-one.
| Compound Name | but-1-ene;2-(cyclopent-2-en-1-ylmethyl)-4-[[(Z)-ethylideneamino]methylamino]-5-methanimidoyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 142964094 |
| Molecular Formula | C18H27N5O |
| Molecular Weight | 329.45 g/mol |
| Exact Mass | 329.22 |
| IUPAC Name | but-1-ene;2-(cyclopent-2-en-1-ylmethyl)-4-[[(Z)-ethylideneamino]methylamino]-5-methanimidoyl-1H-pyrimidin-6-one |
| SMILES | C=CCC.[H]/N=C/c1c(NC/N=C\C)nc(CC2C=CCC2)[nH]c1=O |
| InChI | InChI=1S/C14H19N5O.C4H8/c1-2-16-9-17-13-11(8-15)14(20)19-12(18-13)7-10-5-3-4-6-10;1-3-4-2/h2-3,5,8,10,15H,4,6-7,9H2,1H3,(H2,17,18,19,20);3H,1,4H2,2H3/b15-8+,16-2-; |
| InChIKey | LWBSCMPCCQICRE-ZUNNNVNDSA-N |
| XLogP | 3.32 |
| TPSA | 93.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.45 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|