C18H31N5O — CID 142964108
2-(cyclopentylmethyl)-5-methanimidoyl-4-(prop-2-enylamino)-1H-pyrimidin-6-one;ethane;N-methylmethanimine (PubChem CID 142964108) has the molecular formula C18H31N5O and a molecular weight of 333.48 g/mol. Its IUPAC name is 2-(cyclopentylmethyl)-5-methanimidoyl-4-(prop-2-enylamino)-1H-pyrimidin-6-one;ethane;N-methylmethanimine.
| Compound Name | 2-(cyclopentylmethyl)-5-methanimidoyl-4-(prop-2-enylamino)-1H-pyrimidin-6-one;ethane;N-methylmethanimine |
|---|---|
| PubChem CID | 142964108 |
| Molecular Formula | C18H31N5O |
| Molecular Weight | 333.48 g/mol |
| Exact Mass | 333.25 |
| IUPAC Name | 2-(cyclopentylmethyl)-5-methanimidoyl-4-(prop-2-enylamino)-1H-pyrimidin-6-one;ethane;N-methylmethanimine |
| SMILES | C=NC.CC.[H]/N=C/c1c(NCC=C)nc(CC2CCCC2)[nH]c1=O |
| InChI | InChI=1S/C14H20N4O.C2H5N.C2H6/c1-2-7-16-13-11(9-15)14(19)18-12(17-13)8-10-5-3-4-6-10;1-3-2;1-2/h2,9-10,15H,1,3-8H2,(H2,16,17,18,19);1H2,2H3;1-2H3/b15-9+;; |
| InChIKey | KVISYHHBWCDEEQ-CBNWXSEKSA-N |
| XLogP | 3.44 |
| TPSA | 93.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.48 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|