C23H40OS2 — CID 142964433
ethane;1-ethyl-2-ethylsulfanyl-6-[(1E,3Z)-hexa-1,3,5-trienyl]-1λ4-thiacyclohepta-3,5,7-triene;pentan-1-ol (PubChem CID 142964433) has the molecular formula C23H40OS2 and a molecular weight of 396.71 g/mol. Its IUPAC name is ethane;1-ethyl-2-ethylsulfanyl-6-[(1E,3Z)-hexa-1,3,5-trienyl]-1λ4-thiacyclohepta-3,5,7-triene;pentan-1-ol.
| Compound Name | ethane;1-ethyl-2-ethylsulfanyl-6-[(1E,3Z)-hexa-1,3,5-trienyl]-1λ4-thiacyclohepta-3,5,7-triene;pentan-1-ol |
|---|---|
| PubChem CID | 142964433 |
| Molecular Formula | C23H40OS2 |
| Molecular Weight | 396.71 g/mol |
| Exact Mass | 396.25 |
| IUPAC Name | ethane;1-ethyl-2-ethylsulfanyl-6-[(1E,3Z)-hexa-1,3,5-trienyl]-1λ4-thiacyclohepta-3,5,7-triene;pentan-1-ol |
| SMILES | C=C/C=C\C=C\C1=CC=CC(SCC)S(CC)=C1.CC.CCCCCO |
| InChI | InChI=1S/C16H22S2.C5H12O.C2H6/c1-4-7-8-9-11-15-12-10-13-16(17-5-2)18(6-3)14-15;1-2-3-4-5-6;1-2/h4,7-14,16H,1,5-6H2,2-3H3;6H,2-5H2,1H3;1-2H3/b8-7-,11-9+;; |
| InChIKey | ZNMUDYKZRBKYDB-GWHJHKEKSA-N |
| XLogP | 7.15 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.71 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|