C17H30OS — CID 143618987
6-(2,6-dimethylcyclohepta-1,3,6-trien-1-yl)sulfanylhexan-1-ol;ethane (PubChem CID 143618987) has the molecular formula C17H30OS and a molecular weight of 282.49 g/mol. Its IUPAC name is 6-(2,6-dimethylcyclohepta-1,3,6-trien-1-yl)sulfanylhexan-1-ol;ethane.
| Compound Name | 6-(2,6-dimethylcyclohepta-1,3,6-trien-1-yl)sulfanylhexan-1-ol;ethane |
|---|---|
| PubChem CID | 143618987 |
| Molecular Formula | C17H30OS |
| Molecular Weight | 282.49 g/mol |
| Exact Mass | 282.20 |
| IUPAC Name | 6-(2,6-dimethylcyclohepta-1,3,6-trien-1-yl)sulfanylhexan-1-ol;ethane |
| SMILES | CC.CC1=CC(SCCCCCCO)=C(C)C=CC1 |
| InChI | InChI=1S/C15H24OS.C2H6/c1-13-8-7-9-14(2)15(12-13)17-11-6-4-3-5-10-16;1-2/h7,9,12,16H,3-6,8,10-11H2,1-2H3;1-2H3 |
| InChIKey | DZVUENPXDXKYNN-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.49 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|