C16H27OS+ — CID 143336825
[(Z,5Z)-3-ethyl-5-(4-hydroxy-2-methylidenecyclohexylidene)pent-3-en-2-yl]-dimethylsulfanium (PubChem CID 143336825) has the molecular formula C16H27OS+ and a molecular weight of 267.46 g/mol. Its IUPAC name is [(Z,5Z)-3-ethyl-5-(4-hydroxy-2-methylidenecyclohexylidene)pent-3-en-2-yl]-dimethylsulfanium.
| Compound Name | [(Z,5Z)-3-ethyl-5-(4-hydroxy-2-methylidenecyclohexylidene)pent-3-en-2-yl]-dimethylsulfanium |
|---|---|
| PubChem CID | 143336825 |
| Molecular Formula | C16H27OS+ |
| Molecular Weight | 267.46 g/mol |
| Exact Mass | 267.18 |
| IUPAC Name | [(Z,5Z)-3-ethyl-5-(4-hydroxy-2-methylidenecyclohexylidene)pent-3-en-2-yl]-dimethylsulfanium |
| SMILES | C=C1CC(O)CC/C1=C/C=C(/CC)C(C)[S+](C)C |
| InChI | InChI=1S/C16H27OS/c1-6-14(13(3)18(4)5)7-8-15-9-10-16(17)11-12(15)2/h7-8,13,16-17H,2,6,9-11H2,1,3-5H3/q+1/b14-7-,15-8- |
| InChIKey | GEDONHYGWCZRRW-UOUVAZQYSA-N |
| XLogP | 3.62 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.46 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|