About butanedial;5-chloro-1-[(4-dibenzofuran-4-ylphenyl)methyl]-3-methylindole;methanol
butanedial;5-chloro-1-[(4-dibenzofuran-4-ylphenyl)methyl]-3-methylindole;methanol (PubChem CID 142965975) has the molecular formula C33H30ClNO4
and a molecular weight of 540.06 g/mol. Its IUPAC name is butanedial;5-chloro-1-[(4-dibenzofuran-4-ylphenyl)methyl]-3-methylindole;methanol.
Molecular Properties
| Compound Name | butanedial;5-chloro-1-[(4-dibenzofuran-4-ylphenyl)methyl]-3-methylindole;methanol |
| PubChem CID | 142965975 |
| Molecular Formula | C33H30ClNO4 |
| Molecular Weight | 540.06 g/mol |
| Exact Mass | 539.19 |
| IUPAC Name | butanedial;5-chloro-1-[(4-dibenzofuran-4-ylphenyl)methyl]-3-methylindole;methanol |
| SMILES | CO.Cc1cn(Cc2ccc(-c3cccc4c3oc3ccccc34)cc2)c2ccc(Cl)cc12.O=CCCC=O |
| InChI | InChI=1S/C28H20ClNO.C4H6O2.CH4O/c1-18-16-30(26-14-13-21(29)15-25(18)26)17-19-9-11-20(12-10-19)22-6-4-7-24-23-5-2-3-8-27(23)31-28(22)24;5-3-1-2-4-6;1-2/h2-16H,17H2,1H3;3-4H,1-2H2;2H,1H3 |
| InChIKey | GIEUBNFSSRAKDC-UHFFFAOYSA-N |
| XLogP | 7.99 |
| TPSA | 72.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 540.06 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze butanedial;5-chloro-1-[(4-dibenzofuran-4-ylphenyl)methyl]-3-methylindole;methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butanedial;5-chloro-1-[(4-dibenzofuran-4-ylphenyl)methyl]-3-methylindole;methanol?
The IUPAC name of butanedial;5-chloro-1-[(4-dibenzofuran-4-ylphenyl)methyl]-3-methylindole;methanol (CID 142965975) is butanedial;5-chloro-1-[(4-dibenzofuran-4-ylphenyl)methyl]-3-methylindole;methanol.
What is the SMILES notation for butanedial;5-chloro-1-[(4-dibenzofuran-4-ylphenyl)methyl]-3-methylindole;methanol?
The canonical SMILES for butanedial;5-chloro-1-[(4-dibenzofuran-4-ylphenyl)methyl]-3-methylindole;methanol is CO.Cc1cn(Cc2ccc(-c3cccc4c3oc3ccccc34)cc2)c2ccc(Cl)cc12.O=CCCC=O.
What is the InChIKey of butanedial;5-chloro-1-[(4-dibenzofuran-4-ylphenyl)methyl]-3-methylindole;methanol?
The InChIKey is GIEUBNFSSRAKDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H20ClNO.C4H6O2.CH4O/c1-18-16-30(26-14-13-21(29)15-25(18)26)17-19-9-11-20(12-10-19)22-6-4-7-24-23-5-2-3-8-27(23)31-28(22)24;5-3-1-2-4-6;1-2/h2-16H,17H2,1H3;3-4H,1-2H2;2H,1H3.
What are the key properties of butanedial;5-chloro-1-[(4-dibenzofuran-4-ylphenyl)methyl]-3-methylindole;methanol?
butanedial;5-chloro-1-[(4-dibenzofuran-4-ylphenyl)methyl]-3-methylindole;methanol has a molecular weight of 540.06 g/mol, XLogP of 7.99, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for butanedial;5-chloro-1-[(4-dibenzofuran-4-ylphenyl)methyl]-3-methylindole;methanol is sourced from PubChem (CID 142965975), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).