C25H19ClFN3O3 — CID 69372814
3-(5-chloro-1-piperidin-4-ylindol-3-yl)-4-(6-fluoro-1-benzofuran-7-yl)pyrrole-2,5-dione (PubChem CID 69372814) has the molecular formula C25H19ClFN3O3 and a molecular weight of 463.90 g/mol. Its IUPAC name is 3-(5-chloro-1-piperidin-4-ylindol-3-yl)-4-(6-fluoro-1-benzofuran-7-yl)pyrrole-2,5-dione.
| Compound Name | 3-(5-chloro-1-piperidin-4-ylindol-3-yl)-4-(6-fluoro-1-benzofuran-7-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 69372814 |
| Molecular Formula | C25H19ClFN3O3 |
| Molecular Weight | 463.90 g/mol |
| Exact Mass | 463.11 |
| IUPAC Name | 3-(5-chloro-1-piperidin-4-ylindol-3-yl)-4-(6-fluoro-1-benzofuran-7-yl)pyrrole-2,5-dione |
| SMILES | O=C1NC(=O)C(c2c(F)ccc3ccoc23)=C1c1cn(C2CCNCC2)c2ccc(Cl)cc12 |
| InChI | InChI=1S/C25H19ClFN3O3/c26-14-2-4-19-16(11-14)17(12-30(19)15-5-8-28-9-6-15)20-22(25(32)29-24(20)31)21-18(27)3-1-13-7-10-33-23(13)21/h1-4,7,10-12,15,28H,5-6,8-9H2,(H,29,31,32) |
| InChIKey | ZCIBBEJGQFEHHK-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 76.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.90 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|