C26H45N3O — CID 142966302
[1-[(4E,6Z)-nona-4,6-dien-1-yn-5-yl]piperidin-4-yl]-(4-propan-2-yl-1,4-diazepan-1-yl)methanone;propane (PubChem CID 142966302) has the molecular formula C26H45N3O and a molecular weight of 415.67 g/mol. Its IUPAC name is [1-[(4E,6Z)-nona-4,6-dien-1-yn-5-yl]piperidin-4-yl]-(4-propan-2-yl-1,4-diazepan-1-yl)methanone;propane.
| Compound Name | [1-[(4E,6Z)-nona-4,6-dien-1-yn-5-yl]piperidin-4-yl]-(4-propan-2-yl-1,4-diazepan-1-yl)methanone;propane |
|---|---|
| PubChem CID | 142966302 |
| Molecular Formula | C26H45N3O |
| Molecular Weight | 415.67 g/mol |
| Exact Mass | 415.36 |
| IUPAC Name | [1-[(4E,6Z)-nona-4,6-dien-1-yn-5-yl]piperidin-4-yl]-(4-propan-2-yl-1,4-diazepan-1-yl)methanone;propane |
| SMILES | C#CC/C=C(\C=C/CC)N1CCC(C(=O)N2CCCN(C(C)C)CC2)CC1.CCC |
| InChI | InChI=1S/C23H37N3O.C3H8/c1-5-7-10-22(11-8-6-2)25-16-12-21(13-17-25)23(27)26-15-9-14-24(18-19-26)20(3)4;1-3-2/h1,8,10-11,20-21H,6-7,9,12-19H2,2-4H3;3H2,1-2H3/b11-8-,22-10+; |
| InChIKey | WDOPDNGUQUCDTQ-OZDSPVSJSA-N |
| XLogP | 4.93 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.67 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|