C23H19Cl3FN5OS — CID 142967913
N-[4-(4-amino-7-cyclopentylpyrrolo[2,3-d]pyrimidin-5-yl)-2-fluorophenyl]-2,4,5-trichlorobenzenesulfinamide (PubChem CID 142967913) has the molecular formula C23H19Cl3FN5OS and a molecular weight of 538.86 g/mol. Its IUPAC name is N-[4-(4-amino-7-cyclopentylpyrrolo[2,3-d]pyrimidin-5-yl)-2-fluorophenyl]-2,4,5-trichlorobenzenesulfinamide.
| Compound Name | N-[4-(4-amino-7-cyclopentylpyrrolo[2,3-d]pyrimidin-5-yl)-2-fluorophenyl]-2,4,5-trichlorobenzenesulfinamide |
|---|---|
| PubChem CID | 142967913 |
| Molecular Formula | C23H19Cl3FN5OS |
| Molecular Weight | 538.86 g/mol |
| Exact Mass | 537.04 |
| IUPAC Name | N-[4-(4-amino-7-cyclopentylpyrrolo[2,3-d]pyrimidin-5-yl)-2-fluorophenyl]-2,4,5-trichlorobenzenesulfinamide |
| SMILES | Nc1ncnc2c1c(-c1ccc(NS(=O)c3cc(Cl)c(Cl)cc3Cl)c(F)c1)cn2C1CCCC1 |
| InChI | InChI=1S/C23H19Cl3FN5OS/c24-15-8-17(26)20(9-16(15)25)34(33)31-19-6-5-12(7-18(19)27)14-10-32(13-3-1-2-4-13)23-21(14)22(28)29-11-30-23/h5-11,13,31H,1-4H2,(H2,28,29,30) |
| InChIKey | ATOYGDYSOQPGCC-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.86 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|