C24H24IN5OS — CID 142967828
N-[4-(4-amino-7-cyclopentylpyrrolo[2,3-d]pyrimidin-5-yl)-2-methylphenyl]-4-iodobenzenesulfinamide (PubChem CID 142967828) has the molecular formula C24H24IN5OS and a molecular weight of 557.46 g/mol. Its IUPAC name is N-[4-(4-amino-7-cyclopentylpyrrolo[2,3-d]pyrimidin-5-yl)-2-methylphenyl]-4-iodobenzenesulfinamide.
| Compound Name | N-[4-(4-amino-7-cyclopentylpyrrolo[2,3-d]pyrimidin-5-yl)-2-methylphenyl]-4-iodobenzenesulfinamide |
|---|---|
| PubChem CID | 142967828 |
| Molecular Formula | C24H24IN5OS |
| Molecular Weight | 557.46 g/mol |
| Exact Mass | 557.07 |
| IUPAC Name | N-[4-(4-amino-7-cyclopentylpyrrolo[2,3-d]pyrimidin-5-yl)-2-methylphenyl]-4-iodobenzenesulfinamide |
| SMILES | Cc1cc(-c2cn(C3CCCC3)c3ncnc(N)c23)ccc1NS(=O)c1ccc(I)cc1 |
| InChI | InChI=1S/C24H24IN5OS/c1-15-12-16(6-11-21(15)29-32(31)19-9-7-17(25)8-10-19)20-13-30(18-4-2-3-5-18)24-22(20)23(26)27-14-28-24/h6-14,18,29H,2-5H2,1H3,(H2,26,27,28) |
| InChIKey | IXHYXFYMNKRPII-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.46 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|