C27H34N2O5 — CID 142969996
N-tert-butyl-7-methoxy-2-oxo-8-(2-phenylmethoxypentoxy)-1H-quinoline-3-carboxamide (PubChem CID 142969996) has the molecular formula C27H34N2O5 and a molecular weight of 466.58 g/mol. Its IUPAC name is N-tert-butyl-7-methoxy-2-oxo-8-(2-phenylmethoxypentoxy)-1H-quinoline-3-carboxamide.
| Compound Name | N-tert-butyl-7-methoxy-2-oxo-8-(2-phenylmethoxypentoxy)-1H-quinoline-3-carboxamide |
|---|---|
| PubChem CID | 142969996 |
| Molecular Formula | C27H34N2O5 |
| Molecular Weight | 466.58 g/mol |
| Exact Mass | 466.25 |
| IUPAC Name | N-tert-butyl-7-methoxy-2-oxo-8-(2-phenylmethoxypentoxy)-1H-quinoline-3-carboxamide |
| SMILES | CCCC(COc1c(OC)ccc2cc(C(=O)NC(C)(C)C)c(=O)[nH]c12)OCc1ccccc1 |
| InChI | InChI=1S/C27H34N2O5/c1-6-10-20(33-16-18-11-8-7-9-12-18)17-34-24-22(32-5)14-13-19-15-21(25(30)28-23(19)24)26(31)29-27(2,3)4/h7-9,11-15,20H,6,10,16-17H2,1-5H3,(H,28,30)(H,29,31) |
| InChIKey | WFYYAYIRYMGQAB-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 89.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.58 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |