C29H34N2O6 — CID 11306720
benzyl 1-[(7-methoxy-2-oxo-8-pentoxy-1H-quinoline-3-carbonyl)amino]cyclopentane-1-carboxylate (PubChem CID 11306720) has the molecular formula C29H34N2O6 and a molecular weight of 506.60 g/mol. Its IUPAC name is benzyl 1-[(7-methoxy-2-oxo-8-pentoxy-1H-quinoline-3-carbonyl)amino]cyclopentane-1-carboxylate.
| Compound Name | benzyl 1-[(7-methoxy-2-oxo-8-pentoxy-1H-quinoline-3-carbonyl)amino]cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 11306720 |
| Molecular Formula | C29H34N2O6 |
| Molecular Weight | 506.60 g/mol |
| Exact Mass | 506.24 |
| IUPAC Name | benzyl 1-[(7-methoxy-2-oxo-8-pentoxy-1H-quinoline-3-carbonyl)amino]cyclopentane-1-carboxylate |
| SMILES | CCCCCOc1c(OC)ccc2cc(C(=O)NC3(C(=O)OCc4ccccc4)CCCC3)c(=O)[nH]c12 |
| InChI | InChI=1S/C29H34N2O6/c1-3-4-10-17-36-25-23(35-2)14-13-21-18-22(26(32)30-24(21)25)27(33)31-29(15-8-9-16-29)28(34)37-19-20-11-6-5-7-12-20/h5-7,11-14,18H,3-4,8-10,15-17,19H2,1-2H3,(H,30,32)(H,31,33) |
| InChIKey | ASJHPLOIJMOSKB-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 106.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.60 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|