C25H28N2O6 — CID 142970414
(2R)-2-[(7-methoxy-2-oxo-8-pentoxy-1H-quinoline-3-carbonyl)amino]-3-phenylpropanoic acid (PubChem CID 142970414) has the molecular formula C25H28N2O6 and a molecular weight of 452.51 g/mol. Its IUPAC name is (2R)-2-[(7-methoxy-2-oxo-8-pentoxy-1H-quinoline-3-carbonyl)amino]-3-phenylpropanoic acid.
| Compound Name | (2R)-2-[(7-methoxy-2-oxo-8-pentoxy-1H-quinoline-3-carbonyl)amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 142970414 |
| Molecular Formula | C25H28N2O6 |
| Molecular Weight | 452.51 g/mol |
| Exact Mass | 452.19 |
| IUPAC Name | (2R)-2-[(7-methoxy-2-oxo-8-pentoxy-1H-quinoline-3-carbonyl)amino]-3-phenylpropanoic acid |
| SMILES | CCCCCOc1c(OC)ccc2cc(C(=O)N[C@H](Cc3ccccc3)C(=O)O)c(=O)[nH]c12 |
| InChI | InChI=1S/C25H28N2O6/c1-3-4-8-13-33-22-20(32-2)12-11-17-15-18(24(29)27-21(17)22)23(28)26-19(25(30)31)14-16-9-6-5-7-10-16/h5-7,9-12,15,19H,3-4,8,13-14H2,1-2H3,(H,26,28)(H,27,29)(H,30,31)/t19-/m1/s1 |
| InChIKey | ZGZPRBVPEPAGPN-LJQANCHMSA-N |
| XLogP | 3.53 |
| TPSA | 117.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.51 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|