C21H30N2O6 — CID 142970049
ethane;N-(1-hydroxy-2-methylpropan-2-yl)-8-methoxy-2-oxo-10,13-dioxa-1-azatricyclo[7.6.1.05,16]hexadeca-3,5(16),6,8-tetraene-3-carboxamide (PubChem CID 142970049) has the molecular formula C21H30N2O6 and a molecular weight of 406.48 g/mol. Its IUPAC name is ethane;N-(1-hydroxy-2-methylpropan-2-yl)-8-methoxy-2-oxo-10,13-dioxa-1-azatricyclo[7.6.1.05,16]hexadeca-3,5(16),6,8-tetraene-3-carboxamide.
| Compound Name | ethane;N-(1-hydroxy-2-methylpropan-2-yl)-8-methoxy-2-oxo-10,13-dioxa-1-azatricyclo[7.6.1.05,16]hexadeca-3,5(16),6,8-tetraene-3-carboxamide |
|---|---|
| PubChem CID | 142970049 |
| Molecular Formula | C21H30N2O6 |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.21 |
| IUPAC Name | ethane;N-(1-hydroxy-2-methylpropan-2-yl)-8-methoxy-2-oxo-10,13-dioxa-1-azatricyclo[7.6.1.05,16]hexadeca-3,5(16),6,8-tetraene-3-carboxamide |
| SMILES | CC.COc1ccc2cc(C(=O)NC(C)(C)CO)c(=O)n3c2c1OCCOCC3 |
| InChI | InChI=1S/C19H24N2O6.C2H6/c1-19(2,11-22)20-17(23)13-10-12-4-5-14(25-3)16-15(12)21(18(13)24)6-7-26-8-9-27-16;1-2/h4-5,10,22H,6-9,11H2,1-3H3,(H,20,23);1-2H3 |
| InChIKey | NORAAEFSXKKNCY-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 99.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |