C10H20N6O4 — CID 142971518
2-[(2-aminobutanoylamino)carbamoylamino]-N-(2-amino-2-oxoethyl)propanamide (PubChem CID 142971518) has the molecular formula C10H20N6O4 and a molecular weight of 288.31 g/mol. Its IUPAC name is 2-[(2-aminobutanoylamino)carbamoylamino]-N-(2-amino-2-oxoethyl)propanamide.
| Compound Name | 2-[(2-aminobutanoylamino)carbamoylamino]-N-(2-amino-2-oxoethyl)propanamide |
|---|---|
| PubChem CID | 142971518 |
| Molecular Formula | C10H20N6O4 |
| Molecular Weight | 288.31 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | 2-[(2-aminobutanoylamino)carbamoylamino]-N-(2-amino-2-oxoethyl)propanamide |
| SMILES | CCC(N)C(=O)NNC(=O)NC(C)C(=O)NCC(N)=O |
| InChI | InChI=1S/C10H20N6O4/c1-3-6(11)9(19)15-16-10(20)14-5(2)8(18)13-4-7(12)17/h5-6H,3-4,11H2,1-2H3,(H2,12,17)(H,13,18)(H,15,19)(H2,14,16,20) |
| InChIKey | WGORVLRQCWRQPM-UHFFFAOYSA-N |
| XLogP | -2.96 |
| TPSA | 168.44 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.31 |
| LogP ≤ 5 | -2.96 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|