C29H38N2O3 — CID 142974070
methyl 1-cyclohexyl-3-methyl-2-(4-phenylmethoxyphenyl)-3a,4,5,6,7,7a-hexahydro-2H-benzimidazole-5-carboxylate (PubChem CID 142974070) has the molecular formula C29H38N2O3 and a molecular weight of 462.63 g/mol. Its IUPAC name is methyl 1-cyclohexyl-3-methyl-2-(4-phenylmethoxyphenyl)-3a,4,5,6,7,7a-hexahydro-2H-benzimidazole-5-carboxylate.
| Compound Name | methyl 1-cyclohexyl-3-methyl-2-(4-phenylmethoxyphenyl)-3a,4,5,6,7,7a-hexahydro-2H-benzimidazole-5-carboxylate |
|---|---|
| PubChem CID | 142974070 |
| Molecular Formula | C29H38N2O3 |
| Molecular Weight | 462.63 g/mol |
| Exact Mass | 462.29 |
| IUPAC Name | methyl 1-cyclohexyl-3-methyl-2-(4-phenylmethoxyphenyl)-3a,4,5,6,7,7a-hexahydro-2H-benzimidazole-5-carboxylate |
| SMILES | COC(=O)C1CCC2C(C1)N(C)C(c1ccc(OCc3ccccc3)cc1)N2C1CCCCC1 |
| InChI | InChI=1S/C29H38N2O3/c1-30-27-19-23(29(32)33-2)15-18-26(27)31(24-11-7-4-8-12-24)28(30)22-13-16-25(17-14-22)34-20-21-9-5-3-6-10-21/h3,5-6,9-10,13-14,16-17,23-24,26-28H,4,7-8,11-12,15,18-20H2,1-2H3 |
| InChIKey | YFQPNAHMUXHLLK-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.63 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |