C32H37N3O8 — CID 142975510
4-[5-[4-[1-(3,4-dimethoxyphenyl)-1-hydroxypropan-2-yl]oxy-3-methoxyphenyl]-3,4-dimethyloxolan-2-yl]-2-methoxybenzoyl azide (PubChem CID 142975510) has the molecular formula C32H37N3O8 and a molecular weight of 591.66 g/mol. Its IUPAC name is 4-[5-[4-[1-(3,4-dimethoxyphenyl)-1-hydroxypropan-2-yl]oxy-3-methoxyphenyl]-3,4-dimethyloxolan-2-yl]-2-methoxybenzoyl azide.
| Compound Name | 4-[5-[4-[1-(3,4-dimethoxyphenyl)-1-hydroxypropan-2-yl]oxy-3-methoxyphenyl]-3,4-dimethyloxolan-2-yl]-2-methoxybenzoyl azide |
|---|---|
| PubChem CID | 142975510 |
| Molecular Formula | C32H37N3O8 |
| Molecular Weight | 591.66 g/mol |
| Exact Mass | 591.26 |
| IUPAC Name | 4-[5-[4-[1-(3,4-dimethoxyphenyl)-1-hydroxypropan-2-yl]oxy-3-methoxyphenyl]-3,4-dimethyloxolan-2-yl]-2-methoxybenzoyl azide |
| SMILES | COc1ccc(C(O)C(C)Oc2ccc(C3OC(c4ccc(C(=O)N=[N+]=[N-])c(OC)c4)C(C)C3C)cc2OC)cc1OC |
| InChI | InChI=1S/C32H37N3O8/c1-17-18(2)31(43-30(17)21-8-11-23(26(15-21)39-5)32(37)34-35-33)22-10-13-25(28(16-22)41-7)42-19(3)29(36)20-9-12-24(38-4)27(14-20)40-6/h8-19,29-31,36H,1-7H3 |
| InChIKey | HTHHRPXIBHDDBL-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 141.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.66 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|