C41H49O10 — CID 58443760
CID 58443760 (PubChem CID 58443760) has the molecular formula C41H49O10 and a molecular weight of 701.83 g/mol.
| Compound Name | CID 58443760 |
|---|---|
| PubChem CID | 58443760 |
| Molecular Formula | C41H49O10 |
| Molecular Weight | 701.83 g/mol |
| Exact Mass | 701.33 |
| IUPAC Name | — |
| SMILES | COc1ccc([C@@H](O)[C@@H](C)Oc2ccc(C3OC(c4ccc(O[C@H](C)[C@H](O)c5ccc(OC)c(OC)c5)c(OC)c4)[CH][C@H]3C)cc2OC)cc1C |
| InChI | InChI=1S/C41H49O10/c1-23-18-28(11-14-31(23)44-5)39(42)25(3)49-34-17-13-30(22-38(34)48-9)41-24(2)19-35(51-41)27-10-16-33(37(20-27)47-8)50-26(4)40(43)29-12-15-32(45-6)36(21-29)46-7/h10-22,24-26,35,39-43H,1-9H3/t24-,25-,26-,35?,39+,40+,41?/m1/s1 |
| InChIKey | NJWIIRSKSGOPNT-ZAMRUJDHSA-N |
| XLogP | 7.69 |
| TPSA | 114.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.83 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |