C16H18N3O+ — CID 142975902
[[[amino-(2-methylphenyl)methylidene]amino]-(2-hydroxy-5-methylphenyl)methylidene]azanium (PubChem CID 142975902) has the molecular formula C16H18N3O+ and a molecular weight of 268.34 g/mol. Its IUPAC name is [[[amino-(2-methylphenyl)methylidene]amino]-(2-hydroxy-5-methylphenyl)methylidene]azanium.
| Compound Name | [[[amino-(2-methylphenyl)methylidene]amino]-(2-hydroxy-5-methylphenyl)methylidene]azanium |
|---|---|
| PubChem CID | 142975902 |
| Molecular Formula | C16H18N3O+ |
| Molecular Weight | 268.34 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | [[[amino-(2-methylphenyl)methylidene]amino]-(2-hydroxy-5-methylphenyl)methylidene]azanium |
| SMILES | Cc1ccc(O)c(C(=[NH2+])/N=C(\N)c2ccccc2C)c1 |
| InChI | InChI=1S/C16H17N3O/c1-10-7-8-14(20)13(9-10)16(18)19-15(17)12-6-4-3-5-11(12)2/h3-9,20H,1-2H3,(H3,17,18,19)/p+1 |
| InChIKey | XZRBFRPEBLPQNK-UHFFFAOYSA-O |
| XLogP | 0.92 |
| TPSA | 84.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.34 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|