C13H18N2 — CID 143963962
2,5-dimethyl-N'-(2-methylprop-1-enyl)benzenecarboximidamide (PubChem CID 143963962) has the molecular formula C13H18N2 and a molecular weight of 202.30 g/mol. Its IUPAC name is 2,5-dimethyl-N'-(2-methylprop-1-enyl)benzenecarboximidamide.
| Compound Name | 2,5-dimethyl-N'-(2-methylprop-1-enyl)benzenecarboximidamide |
|---|---|
| PubChem CID | 143963962 |
| Molecular Formula | C13H18N2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | 2,5-dimethyl-N'-(2-methylprop-1-enyl)benzenecarboximidamide |
| SMILES | CC(C)=C/N=C(\N)c1cc(C)ccc1C |
| InChI | InChI=1S/C13H18N2/c1-9(2)8-15-13(14)12-7-10(3)5-6-11(12)4/h5-8H,1-4H3,(H2,14,15) |
| InChIKey | HOFKQUQPMQKHOB-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|