C12H13N — CID 46919401
(E)-3-(2,5-dimethylphenyl)but-2-enenitrile (PubChem CID 46919401) has the molecular formula C12H13N and a molecular weight of 171.24 g/mol. Its IUPAC name is (E)-3-(2,5-dimethylphenyl)but-2-enenitrile.
| Compound Name | (E)-3-(2,5-dimethylphenyl)but-2-enenitrile |
|---|---|
| PubChem CID | 46919401 |
| Molecular Formula | C12H13N |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.10 |
| IUPAC Name | (E)-3-(2,5-dimethylphenyl)but-2-enenitrile |
| SMILES | C/C(=C\C#N)c1cc(C)ccc1C |
| InChI | InChI=1S/C12H13N/c1-9-4-5-10(2)12(8-9)11(3)6-7-13/h4-6,8H,1-3H3/b11-6+ |
| InChIKey | ACKCFPNHQIASKK-IZZDOVSWSA-N |
| XLogP | 3.23 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|