C22H25F3N6OS — CID 142976428
4-[2-methoxy-3-methyl-5-[3-(trifluoromethyl)phenyl]imidazol-4-yl]-N-(1-methylsulfanylpiperidin-4-yl)pyrimidin-2-amine (PubChem CID 142976428) has the molecular formula C22H25F3N6OS and a molecular weight of 478.54 g/mol. Its IUPAC name is 4-[2-methoxy-3-methyl-5-[3-(trifluoromethyl)phenyl]imidazol-4-yl]-N-(1-methylsulfanylpiperidin-4-yl)pyrimidin-2-amine.
| Compound Name | 4-[2-methoxy-3-methyl-5-[3-(trifluoromethyl)phenyl]imidazol-4-yl]-N-(1-methylsulfanylpiperidin-4-yl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 142976428 |
| Molecular Formula | C22H25F3N6OS |
| Molecular Weight | 478.54 g/mol |
| Exact Mass | 478.18 |
| IUPAC Name | 4-[2-methoxy-3-methyl-5-[3-(trifluoromethyl)phenyl]imidazol-4-yl]-N-(1-methylsulfanylpiperidin-4-yl)pyrimidin-2-amine |
| SMILES | COc1nc(-c2cccc(C(F)(F)F)c2)c(-c2ccnc(NC3CCN(SC)CC3)n2)n1C |
| InChI | InChI=1S/C22H25F3N6OS/c1-30-19(17-7-10-26-20(28-17)27-16-8-11-31(33-3)12-9-16)18(29-21(30)32-2)14-5-4-6-15(13-14)22(23,24)25/h4-7,10,13,16H,8-9,11-12H2,1-3H3,(H,26,27,28) |
| InChIKey | FUMXJCDJDMKWOC-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 68.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.54 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|