C27H43ClN4O2 — CID 142976511
4-chloro-N-methylcyclohepta-1,5-dien-1-amine;N-hydroxy-7-(N-methyl-4-piperidin-1-ylanilino)heptanamide (PubChem CID 142976511) has the molecular formula C27H43ClN4O2 and a molecular weight of 491.12 g/mol. Its IUPAC name is 4-chloro-N-methylcyclohepta-1,5-dien-1-amine;N-hydroxy-7-(N-methyl-4-piperidin-1-ylanilino)heptanamide.
| Compound Name | 4-chloro-N-methylcyclohepta-1,5-dien-1-amine;N-hydroxy-7-(N-methyl-4-piperidin-1-ylanilino)heptanamide |
|---|---|
| PubChem CID | 142976511 |
| Molecular Formula | C27H43ClN4O2 |
| Molecular Weight | 491.12 g/mol |
| Exact Mass | 490.31 |
| IUPAC Name | 4-chloro-N-methylcyclohepta-1,5-dien-1-amine;N-hydroxy-7-(N-methyl-4-piperidin-1-ylanilino)heptanamide |
| SMILES | CN(CCCCCCC(=O)NO)c1ccc(N2CCCCC2)cc1.CNC1=CCC(Cl)C=CC1 |
| InChI | InChI=1S/C19H31N3O2.C8H12ClN/c1-21(14-6-3-2-5-9-19(23)20-24)17-10-12-18(13-11-17)22-15-7-4-8-16-22;1-10-8-4-2-3-7(9)5-6-8/h10-13,24H,2-9,14-16H2,1H3,(H,20,23);2-3,6-7,10H,4-5H2,1H3 |
| InChIKey | CHHMNTMJQVDJPY-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 67.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.12 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|