C31H40N4O3 — CID 11399442
N-hydroxy-7-[N-(1-naphthalen-1-ylethylcarbamoyl)-4-piperidin-1-ylanilino]heptanamide (PubChem CID 11399442) has the molecular formula C31H40N4O3 and a molecular weight of 516.69 g/mol. Its IUPAC name is N-hydroxy-7-[N-(1-naphthalen-1-ylethylcarbamoyl)-4-piperidin-1-ylanilino]heptanamide.
| Compound Name | N-hydroxy-7-[N-(1-naphthalen-1-ylethylcarbamoyl)-4-piperidin-1-ylanilino]heptanamide |
|---|---|
| PubChem CID | 11399442 |
| Molecular Formula | C31H40N4O3 |
| Molecular Weight | 516.69 g/mol |
| Exact Mass | 516.31 |
| IUPAC Name | N-hydroxy-7-[N-(1-naphthalen-1-ylethylcarbamoyl)-4-piperidin-1-ylanilino]heptanamide |
| SMILES | CC(NC(=O)N(CCCCCCC(=O)NO)c1ccc(N2CCCCC2)cc1)c1cccc2ccccc12 |
| InChI | InChI=1S/C31H40N4O3/c1-24(28-15-11-13-25-12-6-7-14-29(25)28)32-31(37)35(23-10-3-2-5-16-30(36)33-38)27-19-17-26(18-20-27)34-21-8-4-9-22-34/h6-7,11-15,17-20,24,38H,2-5,8-10,16,21-23H2,1H3,(H,32,37)(H,33,36) |
| InChIKey | HBAQUOROHULUQD-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 84.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.69 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|