C18H29N7O3 — CID 142976669
N-[2-[2-(ethoxymethyl)-4-hydrazinyl-6,7-dimethylimidazo[4,5-c]pyridin-1-yl]ethyl]morpholine-4-carboxamide (PubChem CID 142976669) has the molecular formula C18H29N7O3 and a molecular weight of 391.48 g/mol. Its IUPAC name is N-[2-[2-(ethoxymethyl)-4-hydrazinyl-6,7-dimethylimidazo[4,5-c]pyridin-1-yl]ethyl]morpholine-4-carboxamide.
| Compound Name | N-[2-[2-(ethoxymethyl)-4-hydrazinyl-6,7-dimethylimidazo[4,5-c]pyridin-1-yl]ethyl]morpholine-4-carboxamide |
|---|---|
| PubChem CID | 142976669 |
| Molecular Formula | C18H29N7O3 |
| Molecular Weight | 391.48 g/mol |
| Exact Mass | 391.23 |
| IUPAC Name | N-[2-[2-(ethoxymethyl)-4-hydrazinyl-6,7-dimethylimidazo[4,5-c]pyridin-1-yl]ethyl]morpholine-4-carboxamide |
| SMILES | CCOCc1nc2c(NN)nc(C)c(C)c2n1CCNC(=O)N1CCOCC1 |
| InChI | InChI=1S/C18H29N7O3/c1-4-27-11-14-22-15-16(12(2)13(3)21-17(15)23-19)25(14)6-5-20-18(26)24-7-9-28-10-8-24/h4-11,19H2,1-3H3,(H,20,26)(H,21,23) |
| InChIKey | TWVIWDLIVLZJEV-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 119.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.48 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|