C22H30N6O4S — CID 22729809
1-[3-[4-amino-2-(ethoxymethyl)-6,7-dimethylimidazo[4,5-c]pyridin-1-yl]propyl]-3-(4-methylphenyl)sulfonylurea (PubChem CID 22729809) has the molecular formula C22H30N6O4S and a molecular weight of 474.59 g/mol. Its IUPAC name is 1-[3-[4-amino-2-(ethoxymethyl)-6,7-dimethylimidazo[4,5-c]pyridin-1-yl]propyl]-3-(4-methylphenyl)sulfonylurea.
| Compound Name | 1-[3-[4-amino-2-(ethoxymethyl)-6,7-dimethylimidazo[4,5-c]pyridin-1-yl]propyl]-3-(4-methylphenyl)sulfonylurea |
|---|---|
| PubChem CID | 22729809 |
| Molecular Formula | C22H30N6O4S |
| Molecular Weight | 474.59 g/mol |
| Exact Mass | 474.20 |
| IUPAC Name | 1-[3-[4-amino-2-(ethoxymethyl)-6,7-dimethylimidazo[4,5-c]pyridin-1-yl]propyl]-3-(4-methylphenyl)sulfonylurea |
| SMILES | CCOCc1nc2c(N)nc(C)c(C)c2n1CCCNC(=O)NS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C22H30N6O4S/c1-5-32-13-18-26-19-20(15(3)16(4)25-21(19)23)28(18)12-6-11-24-22(29)27-33(30,31)17-9-7-14(2)8-10-17/h7-10H,5-6,11-13H2,1-4H3,(H2,23,25)(H2,24,27,29) |
| InChIKey | KDDPNEFXKKXBOV-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 141.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.59 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|