C21H26F3N5O3S — CID 23433813
N-[4-[4-amino-2-(ethoxymethyl)-6-methylimidazo[4,5-c]pyridin-1-yl]butyl]-4-(trifluoromethyl)benzenesulfonamide (PubChem CID 23433813) has the molecular formula C21H26F3N5O3S and a molecular weight of 485.53 g/mol. Its IUPAC name is N-[4-[4-amino-2-(ethoxymethyl)-6-methylimidazo[4,5-c]pyridin-1-yl]butyl]-4-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-[4-[4-amino-2-(ethoxymethyl)-6-methylimidazo[4,5-c]pyridin-1-yl]butyl]-4-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 23433813 |
| Molecular Formula | C21H26F3N5O3S |
| Molecular Weight | 485.53 g/mol |
| Exact Mass | 485.17 |
| IUPAC Name | N-[4-[4-amino-2-(ethoxymethyl)-6-methylimidazo[4,5-c]pyridin-1-yl]butyl]-4-(trifluoromethyl)benzenesulfonamide |
| SMILES | CCOCc1nc2c(N)nc(C)cc2n1CCCCNS(=O)(=O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C21H26F3N5O3S/c1-3-32-13-18-28-19-17(12-14(2)27-20(19)25)29(18)11-5-4-10-26-33(30,31)16-8-6-15(7-9-16)21(22,23)24/h6-9,12,26H,3-5,10-11,13H2,1-2H3,(H2,25,27) |
| InChIKey | MNLGSRLDWMGIHJ-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 112.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.53 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|