C18H25N5O3S2 — CID 23433821
N-[4-[4-amino-2-(ethoxymethyl)-6-methylimidazo[4,5-c]pyridin-1-yl]butyl]thiophene-2-sulfonamide (PubChem CID 23433821) has the molecular formula C18H25N5O3S2 and a molecular weight of 423.56 g/mol. Its IUPAC name is N-[4-[4-amino-2-(ethoxymethyl)-6-methylimidazo[4,5-c]pyridin-1-yl]butyl]thiophene-2-sulfonamide.
| Compound Name | N-[4-[4-amino-2-(ethoxymethyl)-6-methylimidazo[4,5-c]pyridin-1-yl]butyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 23433821 |
| Molecular Formula | C18H25N5O3S2 |
| Molecular Weight | 423.56 g/mol |
| Exact Mass | 423.14 |
| IUPAC Name | N-[4-[4-amino-2-(ethoxymethyl)-6-methylimidazo[4,5-c]pyridin-1-yl]butyl]thiophene-2-sulfonamide |
| SMILES | CCOCc1nc2c(N)nc(C)cc2n1CCCCNS(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C18H25N5O3S2/c1-3-26-12-15-22-17-14(11-13(2)21-18(17)19)23(15)9-5-4-8-20-28(24,25)16-7-6-10-27-16/h6-7,10-11,20H,3-5,8-9,12H2,1-2H3,(H2,19,21) |
| InChIKey | RIKRVBHPFFNBFK-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 112.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.56 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|