About 2-(ethoxymethyl)-1,6-dimethylimidazo[4,5-c]pyridin-4-amine
2-(ethoxymethyl)-1,6-dimethylimidazo[4,5-c]pyridin-4-amine (PubChem CID 172604026) has the molecular formula C11H16N4O
and a molecular weight of 220.28 g/mol. Its IUPAC name is 2-(ethoxymethyl)-1,6-dimethylimidazo[4,5-c]pyridin-4-amine.
Molecular Properties
| Compound Name | 2-(ethoxymethyl)-1,6-dimethylimidazo[4,5-c]pyridin-4-amine |
| PubChem CID | 172604026 |
| Molecular Formula | C11H16N4O |
| Molecular Weight | 220.28 g/mol |
| Exact Mass | 220.13 |
| IUPAC Name | 2-(ethoxymethyl)-1,6-dimethylimidazo[4,5-c]pyridin-4-amine |
| SMILES | CCOCc1nc2c(N)nc(C)cc2n1C |
| InChI | InChI=1S/C11H16N4O/c1-4-16-6-9-14-10-8(15(9)3)5-7(2)13-11(10)12/h5H,4,6H2,1-3H3,(H2,12,13) |
| InChIKey | UKFVNSKBIVCNPL-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.28 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(ethoxymethyl)-1,6-dimethylimidazo[4,5-c]pyridin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(ethoxymethyl)-1,6-dimethylimidazo[4,5-c]pyridin-4-amine?
The IUPAC name of 2-(ethoxymethyl)-1,6-dimethylimidazo[4,5-c]pyridin-4-amine (CID 172604026) is 2-(ethoxymethyl)-1,6-dimethylimidazo[4,5-c]pyridin-4-amine.
What is the SMILES notation for 2-(ethoxymethyl)-1,6-dimethylimidazo[4,5-c]pyridin-4-amine?
The canonical SMILES for 2-(ethoxymethyl)-1,6-dimethylimidazo[4,5-c]pyridin-4-amine is CCOCc1nc2c(N)nc(C)cc2n1C.
What is the InChIKey of 2-(ethoxymethyl)-1,6-dimethylimidazo[4,5-c]pyridin-4-amine?
The InChIKey is UKFVNSKBIVCNPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N4O/c1-4-16-6-9-14-10-8(15(9)3)5-7(2)13-11(10)12/h5H,4,6H2,1-3H3,(H2,12,13).
What are the key properties of 2-(ethoxymethyl)-1,6-dimethylimidazo[4,5-c]pyridin-4-amine?
2-(ethoxymethyl)-1,6-dimethylimidazo[4,5-c]pyridin-4-amine has a molecular weight of 220.28 g/mol, XLogP of 1.40, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(ethoxymethyl)-1,6-dimethylimidazo[4,5-c]pyridin-4-amine is sourced from PubChem (CID 172604026), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).