C8H14N2O — CID 117188439
2-(ethoxymethyl)-1,5-dimethylimidazole (PubChem CID 117188439) has the molecular formula C8H14N2O and a molecular weight of 154.21 g/mol. Its IUPAC name is 2-(ethoxymethyl)-1,5-dimethylimidazole.
| Compound Name | 2-(ethoxymethyl)-1,5-dimethylimidazole |
|---|---|
| PubChem CID | 117188439 |
| Molecular Formula | C8H14N2O |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.11 |
| IUPAC Name | 2-(ethoxymethyl)-1,5-dimethylimidazole |
| SMILES | CCOCc1ncc(C)n1C |
| InChI | InChI=1S/C8H14N2O/c1-4-11-6-8-9-5-7(2)10(8)3/h5H,4,6H2,1-3H3 |
| InChIKey | ASNIMHCLIHOPEV-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |