C8H10N4 — CID 141069874
1,6-dimethylimidazo[4,5-c]pyridin-4-amine (PubChem CID 141069874) has the molecular formula C8H10N4 and a molecular weight of 162.20 g/mol. Its IUPAC name is 1,6-dimethylimidazo[4,5-c]pyridin-4-amine.
| Compound Name | 1,6-dimethylimidazo[4,5-c]pyridin-4-amine |
|---|---|
| PubChem CID | 141069874 |
| Molecular Formula | C8H10N4 |
| Molecular Weight | 162.20 g/mol |
| Exact Mass | 162.09 |
| IUPAC Name | 1,6-dimethylimidazo[4,5-c]pyridin-4-amine |
| SMILES | Cc1cc2c(ncn2C)c(N)n1 |
| InChI | InChI=1S/C8H10N4/c1-5-3-6-7(8(9)11-5)10-4-12(6)2/h3-4H,1-2H3,(H2,9,11) |
| InChIKey | JATIDZNXLPXZCA-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.20 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |