C25H39F3N3O3+ — CID 142977023
[1-hydroxy-3-(trifluoromethyl)-7,8-dihydro-5H-1,6-naphthyridin-1-ium-6-yl]-[(3R)-3-[(2-methoxycyclohexyl)amino]cyclopentyl]methanone;propane (PubChem CID 142977023) has the molecular formula C25H39F3N3O3+ and a molecular weight of 486.60 g/mol. Its IUPAC name is [1-hydroxy-3-(trifluoromethyl)-7,8-dihydro-5H-1,6-naphthyridin-1-ium-6-yl]-[(3R)-3-[(2-methoxycyclohexyl)amino]cyclopentyl]methanone;propane.
| Compound Name | [1-hydroxy-3-(trifluoromethyl)-7,8-dihydro-5H-1,6-naphthyridin-1-ium-6-yl]-[(3R)-3-[(2-methoxycyclohexyl)amino]cyclopentyl]methanone;propane |
|---|---|
| PubChem CID | 142977023 |
| Molecular Formula | C25H39F3N3O3+ |
| Molecular Weight | 486.60 g/mol |
| Exact Mass | 486.29 |
| IUPAC Name | [1-hydroxy-3-(trifluoromethyl)-7,8-dihydro-5H-1,6-naphthyridin-1-ium-6-yl]-[(3R)-3-[(2-methoxycyclohexyl)amino]cyclopentyl]methanone;propane |
| SMILES | CCC.COC1CCCCC1N[C@@H]1CCC(C(=O)N2CCc3c(cc(C(F)(F)F)c[n+]3O)C2)C1 |
| InChI | InChI=1S/C22H31F3N3O3.C3H8/c1-31-20-5-3-2-4-18(20)26-17-7-6-14(11-17)21(29)27-9-8-19-15(12-27)10-16(13-28(19)30)22(23,24)25;1-3-2/h10,13-14,17-18,20,26,30H,2-9,11-12H2,1H3;3H2,1-2H3/q+1;/t14?,17-,18?,20?;/m1./s1 |
| InChIKey | LXSCCAMYASDJLP-ZVPHTYFBSA-N |
| XLogP | 4.25 |
| TPSA | 65.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.60 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|