C23H30Cl2N2O3 — CID 142979722
1-(2,3-dichlorophenyl)-4-[4-(3,4-dimethoxyphenoxy)pentan-2-yl]piperazine (PubChem CID 142979722) has the molecular formula C23H30Cl2N2O3 and a molecular weight of 453.41 g/mol. Its IUPAC name is 1-(2,3-dichlorophenyl)-4-[4-(3,4-dimethoxyphenoxy)pentan-2-yl]piperazine.
| Compound Name | 1-(2,3-dichlorophenyl)-4-[4-(3,4-dimethoxyphenoxy)pentan-2-yl]piperazine |
|---|---|
| PubChem CID | 142979722 |
| Molecular Formula | C23H30Cl2N2O3 |
| Molecular Weight | 453.41 g/mol |
| Exact Mass | 452.16 |
| IUPAC Name | 1-(2,3-dichlorophenyl)-4-[4-(3,4-dimethoxyphenoxy)pentan-2-yl]piperazine |
| SMILES | COc1ccc(OC(C)CC(C)N2CCN(c3cccc(Cl)c3Cl)CC2)cc1OC |
| InChI | InChI=1S/C23H30Cl2N2O3/c1-16(14-17(2)30-18-8-9-21(28-3)22(15-18)29-4)26-10-12-27(13-11-26)20-7-5-6-19(24)23(20)25/h5-9,15-17H,10-14H2,1-4H3 |
| InChIKey | UGFPMHCKYZVAHE-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 34.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.41 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |