C12H16F2N2O — CID 142979898
trans-(1R,2R)-N-(cyanomethyl)-5,5-difluoro-2-prop-1-en-2-ylcyclohexane-1-carboxamide (PubChem CID 142979898) has the molecular formula C12H16F2N2O and a molecular weight of 242.27 g/mol. Its IUPAC name is trans-(1R,2R)-N-(cyanomethyl)-5,5-difluoro-2-prop-1-en-2-ylcyclohexane-1-carboxamide.
| Compound Name | trans-(1R,2R)-N-(cyanomethyl)-5,5-difluoro-2-prop-1-en-2-ylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 142979898 |
| Molecular Formula | C12H16F2N2O |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | trans-(1R,2R)-N-(cyanomethyl)-5,5-difluoro-2-prop-1-en-2-ylcyclohexane-1-carboxamide |
| SMILES | C=C(C)[C@@H]1CCC(F)(F)C[C@H]1C(=O)NCC#N |
| InChI | InChI=1S/C12H16F2N2O/c1-8(2)9-3-4-12(13,14)7-10(9)11(17)16-6-5-15/h9-10H,1,3-4,6-7H2,2H3,(H,16,17)/t9-,10+/m0/s1 |
| InChIKey | WSQBUXPJZHBJPM-VHSXEESVSA-N |
| XLogP | 2.25 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|