C10H14F3NO — CID 91223950
4-methylidene-N-(2,2,2-trifluoroethyl)cyclohexane-1-carboxamide (PubChem CID 91223950) has the molecular formula C10H14F3NO and a molecular weight of 221.22 g/mol. Its IUPAC name is 4-methylidene-N-(2,2,2-trifluoroethyl)cyclohexane-1-carboxamide.
| Compound Name | 4-methylidene-N-(2,2,2-trifluoroethyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 91223950 |
| Molecular Formula | C10H14F3NO |
| Molecular Weight | 221.22 g/mol |
| Exact Mass | 221.10 |
| IUPAC Name | 4-methylidene-N-(2,2,2-trifluoroethyl)cyclohexane-1-carboxamide |
| SMILES | C=C1CCC(C(=O)NCC(F)(F)F)CC1 |
| InChI | InChI=1S/C10H14F3NO/c1-7-2-4-8(5-3-7)9(15)14-6-10(11,12)13/h8H,1-6H2,(H,14,15) |
| InChIKey | JDPCYNXIQQXAKZ-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.22 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|