About N-(1,4,4-trifluorobut-2-enyl)cyclohexanecarboxamide
N-(1,4,4-trifluorobut-2-enyl)cyclohexanecarboxamide (PubChem CID 175473621) has the molecular formula C11H16F3NO
and a molecular weight of 235.25 g/mol. Its IUPAC name is N-(1,4,4-trifluorobut-2-enyl)cyclohexanecarboxamide.
Molecular Properties
| Compound Name | N-(1,4,4-trifluorobut-2-enyl)cyclohexanecarboxamide |
| PubChem CID | 175473621 |
| Molecular Formula | C11H16F3NO |
| Molecular Weight | 235.25 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | N-(1,4,4-trifluorobut-2-enyl)cyclohexanecarboxamide |
| SMILES | O=C(NC(F)C=CC(F)F)C1CCCCC1 |
| InChI | InChI=1S/C11H16F3NO/c12-9(13)6-7-10(14)15-11(16)8-4-2-1-3-5-8/h6-10H,1-5H2,(H,15,16) |
| InChIKey | PEBVURWNLRDHNH-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.25 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze N-(1,4,4-trifluorobut-2-enyl)cyclohexanecarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1,4,4-trifluorobut-2-enyl)cyclohexanecarboxamide?
The IUPAC name of N-(1,4,4-trifluorobut-2-enyl)cyclohexanecarboxamide (CID 175473621) is N-(1,4,4-trifluorobut-2-enyl)cyclohexanecarboxamide.
What is the SMILES notation for N-(1,4,4-trifluorobut-2-enyl)cyclohexanecarboxamide?
The canonical SMILES for N-(1,4,4-trifluorobut-2-enyl)cyclohexanecarboxamide is O=C(NC(F)C=CC(F)F)C1CCCCC1.
What is the InChIKey of N-(1,4,4-trifluorobut-2-enyl)cyclohexanecarboxamide?
The InChIKey is PEBVURWNLRDHNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16F3NO/c12-9(13)6-7-10(14)15-11(16)8-4-2-1-3-5-8/h6-10H,1-5H2,(H,15,16).
What are the key properties of N-(1,4,4-trifluorobut-2-enyl)cyclohexanecarboxamide?
N-(1,4,4-trifluorobut-2-enyl)cyclohexanecarboxamide has a molecular weight of 235.25 g/mol, XLogP of 2.80, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1,4,4-trifluorobut-2-enyl)cyclohexanecarboxamide is sourced from PubChem (CID 175473621), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).