C11H16F3NO — CID 175473621
N-(1,4,4-trifluorobut-2-enyl)cyclohexanecarboxamide (PubChem CID 175473621) has the molecular formula C11H16F3NO and a molecular weight of 235.25 g/mol. Its IUPAC name is N-(1,4,4-trifluorobut-2-enyl)cyclohexanecarboxamide.
| Compound Name | N-(1,4,4-trifluorobut-2-enyl)cyclohexanecarboxamide |
|---|---|
| PubChem CID | 175473621 |
| Molecular Formula | C11H16F3NO |
| Molecular Weight | 235.25 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | N-(1,4,4-trifluorobut-2-enyl)cyclohexanecarboxamide |
| SMILES | O=C(NC(F)C=CC(F)F)C1CCCCC1 |
| InChI | InChI=1S/C11H16F3NO/c12-9(13)6-7-10(14)15-11(16)8-4-2-1-3-5-8/h6-10H,1-5H2,(H,15,16) |
| InChIKey | PEBVURWNLRDHNH-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.25 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|