C12H20F3NO — CID 71534603
N-[(E)-4,4,4-trifluorobut-2-enyl]octanamide (PubChem CID 71534603) has the molecular formula C12H20F3NO and a molecular weight of 251.29 g/mol. Its IUPAC name is N-[(E)-4,4,4-trifluorobut-2-enyl]octanamide.
| Compound Name | N-[(E)-4,4,4-trifluorobut-2-enyl]octanamide |
|---|---|
| PubChem CID | 71534603 |
| Molecular Formula | C12H20F3NO |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.15 |
| IUPAC Name | N-[(E)-4,4,4-trifluorobut-2-enyl]octanamide |
| SMILES | CCCCCCCC(=O)NC/C=C/C(F)(F)F |
| InChI | InChI=1S/C12H20F3NO/c1-2-3-4-5-6-8-11(17)16-10-7-9-12(13,14)15/h7,9H,2-6,8,10H2,1H3,(H,16,17)/b9-7+ |
| InChIKey | FOXCTNXXNUKALL-VQHVLOKHSA-N |
| XLogP | 3.58 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|