C11H16F3NO — CID 169226618
N-[(E)-4,4,4-trifluorobut-2-enyl]cyclohexanecarboxamide (PubChem CID 169226618) has the molecular formula C11H16F3NO and a molecular weight of 235.25 g/mol. Its IUPAC name is N-[(E)-4,4,4-trifluorobut-2-enyl]cyclohexanecarboxamide.
| Compound Name | N-[(E)-4,4,4-trifluorobut-2-enyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 169226618 |
| Molecular Formula | C11H16F3NO |
| Molecular Weight | 235.25 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | N-[(E)-4,4,4-trifluorobut-2-enyl]cyclohexanecarboxamide |
| SMILES | O=C(NC/C=C/C(F)(F)F)C1CCCCC1 |
| InChI | InChI=1S/C11H16F3NO/c12-11(13,14)7-4-8-15-10(16)9-5-2-1-3-6-9/h4,7,9H,1-3,5-6,8H2,(H,15,16)/b7-4+ |
| InChIKey | LRUCJPGPQNKOSS-QPJJXVBHSA-N |
| XLogP | 2.80 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.25 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|