C13H19F2NO — CID 178011082
N-[(E)-but-2-enyl]-6,6-difluorospiro[2.5]octane-2-carboxamide (PubChem CID 178011082) has the molecular formula C13H19F2NO and a molecular weight of 243.30 g/mol. Its IUPAC name is N-[(E)-but-2-enyl]-6,6-difluorospiro[2.5]octane-2-carboxamide.
| Compound Name | N-[(E)-but-2-enyl]-6,6-difluorospiro[2.5]octane-2-carboxamide |
|---|---|
| PubChem CID | 178011082 |
| Molecular Formula | C13H19F2NO |
| Molecular Weight | 243.30 g/mol |
| Exact Mass | 243.14 |
| IUPAC Name | N-[(E)-but-2-enyl]-6,6-difluorospiro[2.5]octane-2-carboxamide |
| SMILES | C/C=C/CNC(=O)C1CC12CCC(F)(F)CC2 |
| InChI | InChI=1S/C13H19F2NO/c1-2-3-8-16-11(17)10-9-12(10)4-6-13(14,15)7-5-12/h2-3,10H,4-9H2,1H3,(H,16,17)/b3-2+ |
| InChIKey | TXWZZIORMFOJPC-NSCUHMNNSA-N |
| XLogP | 2.89 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.30 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|